Piperazine D8
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-30499 |
| Alternative Name(s) | Terazosin;Piperazine-2,2,3,3,5,5,6,6 D8 |
| Research Area | Labeled Piperazine, intended for use as an internal standard for the quantification of Piperazine by GC- or LC-mass spectrometry. |
| Molecular Formula | C4H4DCl2N2 |
| CAS# | 134628-42-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C1([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H])N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30499.html |
| Additional Information | NULL |