Fipronil
Agro Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-23647 |
| Alternative Name(s) | 5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-4-((trifluoromethyl)sulfinyl)-1H-pyrazole-3-carbonitrile |
| Research Area | A broad spectrum insecticide which actively disrupts the CNS of contacted insects by blocking the passage of chloride ions through GABA receptors. |
| Molecular Formula | C12H4Cl2F6N4OS |
| CAS# | 120068-37-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(N(C(C(Cl)=CC(C(F)(F)F)=C1)=C1Cl)N=C2C#N)=C2[S](C(F)(F)F)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST23647.html |
| Additional Information | NULL |