(-)-Epinephrine
Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-T-21753 |
| Alternative Name(s) | 4-(1-hydroxy-2-(methylamino)ethyl)benzene-1,2-diol |
| Research Area | Endogenous catcholamine with combined a-and ß-agonist activity. Principal sympathomimetic hormone produced by the adrenal medulla. Bronchodilator; cardiostimulant; mydriatic; antiglaucoma. |
| Molecular Formula | C9H13NO3 |
| CAS# | 51-43-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H](C1=CC(O)=C(O)C=C1)CNC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST21753.html |
| Additional Information | NULL |