Pentanoic Acid D9
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-14313 |
| Alternative Name(s) | (D9)pentanoic acid;Pentanoic D9 Acid;Valeric-d9 acid;Valeric acid D9. |
| Research Area | Labeled Pentanoic Acid, intended for use as an internal standard for the quantification of Pentanoic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 115871-50-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14313.html |
| Additional Information | NULL |