Naphthalene D8
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-15212 |
| Alternative Name(s) | (D8)naphthalene. |
| Research Area | Labeled Naphthalene , intended for use as an internal standard for the quantification of Naphthalene by GC- or LC-mass spectrometry. |
| Molecular Formula | C10D8 |
| CAS# | 1146-65-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C(C(C(C([2H])=C1[2H])=C2[2H])=C(C([2H])=C2[2H])[2H])=C1[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15212.html |
| Additional Information | NULL |