Alpha Hederin
Phytochemicals
| Trivial name | NULL |
| Catalog Number | CS-O-10015 |
| Alternative Name(s) | (3-Beta,4Alpha)-3-[[2-O-(6-Deoxy-Alpha-L-mannopyranosyl)-Alpha-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-oic acid;(3-β,4α)-3-[[2-O-(6-Deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-oc cid |
| Research Area | Alpha-Hederin is a saponin of dry extracts from the leaves of Hedera helix L.Inhibitor of -Beta2-adrenergic receptor-GFP fusion proteins. Potential cause for asphyxiation. |
| Molecular Formula | C42H68O12 |
| CAS# | 27013-91-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1([H])[C@]2(CC[C@@H]3O[C@@](OC[C@H](O)[C@@H]4O)([H])[C@@H]4O[C@@](O[C@@H](C)[C@H](O)[C@H]5O)([H])[C@@H]5O)C)(CC[C@@]2([H])[C@]3(C)CO)[C@@](C6=CC1)(CC[C@]7(C(O)=O)[C@@]6([H])CC(C)(C)CC7)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10015.html |
| Additional Information | NULL |
