Diflubenzuron
Pesticides
| Trivial name | NULL |
| Catalog Number | CS-T-18303 |
| Alternative Name(s) | N-[[difluorobenzamide |
| Research Area | Diflubenzuron is a benzoylurea-based pesticide belonging to the benzamide class. Diflubenzuron is a chitin synthesis inhibitor. Diflubenzuron is used in both agriculture and forest management to selectively control insect pests, particularly moths and weevils. |
| Molecular Formula | C14H9ClF2N2O2 |
| CAS# | 35367-38-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(F)=CC=C1)=C1F)NC(NC2=CC=C(Cl)C=C2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST18303.html |
| Additional Information | NULL |