O-Arsanilic acid
Inhibitors
| Trivial name | NULL |
| Catalog Number | CS-O-30709 |
| Alternative Name(s) | (2-Aminophenyl)arsonic Acid;(2-aminophenyl)arsonic acid |
| Research Area | o-Arsanilic Acid is an organoarsenic compound. o-Arsanilic Acid is a highly toxic contaminant and can be found in plants growing in contaminated soil. |
| Molecular Formula | C6H8AsNO3 |
| CAS# | 2045-00-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[As](O)(C(C=CC=C1)=C1N)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30709.html |
| Additional Information | NULL |