Calcium gluconate
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-30549 |
| Alternative Name(s) | calcium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate; 18016-24-5 ; CS-DV-03505 |
| Research Area | Calcium Gluconate is used as an inert ingredient in pesticide formulations applied to crops. It is also used as a supplement to fortify beverages and foods lacking a sufficient amount of calcium. |
| Molecular Formula | C12H22CaO14 |
| CAS# | 299-28-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@@H](O)C([O-])=O)[C@H](O)[C@H](O)CO.O[C@H]([C@@H](O)C([O-])=O)[C@H](O)[C@H](O)CO.[Ca+2] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30549.html |
| Additional Information | NULL |