Dansyl Chloride
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-10936 |
| Alternative Name(s) | 5-(Dimethylamino)-1-naphthalenesulfonyl Chloride;5-(dimethylamino)naphthalene-1-sulfonyl chloride |
| Research Area | Reagent for fluorescent labelling of amines, amino acids and proteins. |
| Molecular Formula | C12H12ClNO2S |
| CAS# | 605-65-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | Cl[S](=O)(C(C1=CC=C2)=CC=CC1=C2N(C)C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10936.html |
| Additional Information | NULL |