2-Amino-2-methylpropanol
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-47942 |
| Alternative Name(s) | AMP; 2-amino-2-methylpropan-1-ol |
| Research Area | Used for the preparation of buffer solutions, suitable for the determination of alkaline phosphatase. |
| Molecular Formula | NULL |
| CAS# | 124-68-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C([2H])([2H])[2H])(C([2H])[2H])C([2H])([2H])O[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST47942.html |
| Additional Information | NULL |