8-Chlorotheophylline
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-12672 |
| Alternative Name(s) | 8-chloro-3,9-dihydro-1,3-dimethyl-1H-Purine-2,6-dione |
| Research Area | A stimulant drug. It can be used as a binding agent to form stable salts of pharmaceutical drugs. |
| Molecular Formula | NULL |
| CAS# | 85-18-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1C)C(N=C(Cl)N2)=C2N(C)C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST12672.html |
| Additional Information | NULL |