Uric Acid
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-46164 |
| Alternative Name(s) | 7,9-Dihydro-1H-Purine-2,6,8(3H)-trione;7,9-Dihydro-1H-Purine-2,6,8(3H)-trione |
| Research Area | Uric Acid is a heterocyclcic compound that is created when purine nucleotides are broken down of by the human body. High blood concetration of Uric Acid is known as hyperuricemia and is often associated with a wide range of disorders and medical conditions such as gout, diabetes and metabolic syndrome. Uric acid may be a marker of oxidative stress and may have a potential therapeutic role as an antioxidant. |
| Molecular Formula | C5H4N4O3 |
| CAS# | 69-93-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(NC1=O)C(N2)=C(N1)NC2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST46164.html |
| Additional Information | NULL |