Propantheline Bromide
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-40617 |
| Alternative Name(s) | (2-Hydroxyethyl)diisopropylmethylammonium Bromide Xanthene-9-carboxylate;N-(2-((9H-xanthene-9-carbonyl)oxy)ethyl)-N-isopropyl-N-methylpropan-2-aminium bromide;N-Methyl-N-(1-methylethyl)-N-[2-[(9H-xanthen-9-ylcarbonyl)oxy]ethyl]-2-propanaminium Bromide |
| Research Area | Propantheline is an antimuscarinic agent used in the treatment of hyperhidrosis (excessive sweating), enuresis (involuntary urination) as well as cramps or spasms of the stomach, intestine and bladder. |
| Molecular Formula | C23H30BrNO3 |
| CAS# | 50-34-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1C(C=CC=C2)=C2OC3=CC=CC=C13)OCC[N+](C(C)C)(C)C(C)C.[Br-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST40617.html |
| Additional Information | NULL |