Dichloride Triphenylphosphine
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-16199 |
| Alternative Name(s) | Dichlorotriphenyl-λ5-phosphane |
| Research Area | A chemical used in the synthesis of the tertiary benzanilide derivatives. |
| Molecular Formula | C18H15Cl2P |
| CAS# | 2526-64-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | Cl[P](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16199.html |
| Additional Information | NULL |