Propargyl Tosylate
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-60795 |
| Alternative Name(s) | prop-2-yn-1-yl 4-methylbenzenesulfonate |
| Research Area | Protected Propargyl. A possible genotoxic compound that can affect the bacterial and mammalian cell systems. |
| Molecular Formula | C10H10O3S |
| CAS# | 6165-76-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](OCC#C)(C1=CC=C(C)C=C1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST60795.html |
| Additional Information | NULL |