Ethacrynic Acid
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-22014 |
| Alternative Name(s) | 2-[2,3henoxy]acetic acid |
| Research Area | A diuretic used to treat high blood pressure and swelling caused by congestive heart failure, liver failure and kidney failure. |
| Molecular Formula | C13H12Cl2O4 |
| CAS# | 58-54-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C=CC(OCC(O)=O)=C1Cl)=C1Cl)C(CC)=C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST22014.html |
| Additional Information | NULL |