Bupropion Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10982 |
| Alternative Name(s) | 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one hydrochloride |
| Research Area | A selective inhibitor of dopamine uptake. An antidepressant of the aminoketone class; aid in smoking cessation. |
| Molecular Formula | C13H19Cl2NO |
| CAS# | 31677-93-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC(Cl)=CC=C1)C(C)NC(C)(C)C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10982.html |
| Additional Information | NULL |