Riboflavin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02238 |
| Alternative Name(s) | Riboflavin;7,8-Dimethyl-10-[(2S,3S,4R)-2,3,4,5tetrahydroxypentyl]benzo[g]pteridine-2,4-dione tetrahydroxypentyl]-2H,3H,4H,10H-benzo[g]pteridine- 2,4-dione;Vitamin B2 ; CS-O-31031 |
| Research Area | Riboflavin is an essential human nutrient that is a heat-stable and water-soluble flavin belonging to the vitamin B family. Riboflavin is a precursor of the coenzymes flavin mononucleotide (FMN) and flavin adenine dinucleotide (FAD). These coenzymes are o |
| Molecular Formula | NULL |
| CAS# | 83-88-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@H](O)[C@H](O)CO)CN1C(C=C(C)C(C)=C2)=C2N=C(C(N3)=O)C1=NC3=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02238.html |
| Additional Information | NULL |