Olanzapine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30992 |
| Alternative Name(s) | 2-Methyl-4-(4-methyl-1-piperazinyl)-10H-thieno[2,3-b][1,5]benzodiazepine |
| Research Area | Olanzapine is a serotonin (5-HT2) and dopamine (D1/D2) receptor antagonist with anticholinergic activity. Antipsychotic. |
| Molecular Formula | C17H20N4S |
| CAS# | 132539-06-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=CC(C(N2C([2H])([2H])C([2H])([2H])N(C)C([2H])([2H])C2([2H])[2H])=NC3=CC=CC=C3N4)=C4S1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30992.html |
| Additional Information | NULL |