Metoprolol tartrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30975 |
| Alternative Name(s) | 1-[4-(2-Methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol Hemi (+)-Tartrate; (1-(Isopropylamino)-3-[4-(2-methoxyethyl) phenoxy] propan-2-ol) |
| Research Area | A ß1 selective aryloxypropanolamine andrenergic antagonist. Used in the treatment of a variety of cardiovascular disorder. Antihypertensive; antianginal; antiarrhythmic (class II). |
| Molecular Formula | C32H52N2O12 |
| CAS# | 56392-17-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C(O)=O)[C@@H](O)C(O)=O.OC(CNC(C)C)COC1=CC=C(CCOC)C=C1.OC(CNC(C)C)COC2=CC=C(CCOC)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30975.html |
| Additional Information | NULL |