Tamoxifen citrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-31029 |
| Alternative Name(s) | (Z)-2-[4-(1,2-Diphenyl-1-butenyl)phenoxy]-N,N-dimethylethanamine 2-Hydroxy-1,2,3-propanetricarboxylate; 2-[4-[(1Z)-1,2-Diphenyl-1-butenyl]phenoxy]-N,N-dimethylethanamine 2-Hydroxy-1,2,3-Propanetricarboxylate |
| Research Area | Tamoxifen Citrate is a selective estrogen response modifier (SERM), protein kinase C inhibitor and anti-angiogenetic factor. Tamoxifen is a prodrug that is metabolized to active metabolites 4-hydroxytamoxifen (4-OHT) and endoxifen by cytochrome P450 isoforms CYP2D6 and CYP3A4. |
| Molecular Formula | C32H37NO8 |
| CAS# | 54965-24-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CC(O)=O)(C(O)=O)CC(O)=O.CC/C(C1=CC=CC=C1)=C(C2=CC=CC=C2)/C3=CC=C(OCCN(C)C)C=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31029.html |
| Additional Information | NULL |