Metronidazole Benzoate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30976 |
| Alternative Name(s) | Benzoylmetronidazole;2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate |
| Research Area | Benzoylmetronildazole is a new class of antiglycation agents used to treat diabetes mellitus. Benzoylmetronildazole is also a derivative of Metronidazole , an antibacterial in the treatment o f rosacea. |
| Molecular Formula | C13H13N3O4 |
| CAS# | 13182-89-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=NC=C([N+]([O-])=O)N1CCOC(C2=CC=CC=C2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30976.html |
| Additional Information | NULL |