Tapentadol Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11752 |
| Alternative Name(s) | 3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenol hydrochloride |
| Research Area | A novel, centrally acting oral analgesic with a dual mode of action that has demonstrated efficacy in preclinical and clinical models of pain relief. |
| Molecular Formula | C14H24ClNO |
| CAS# | 175591-09-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H](CN(C)C)[C@H](C1=CC(O)=CC=C1)CC.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11752.html |
| Additional Information | NULL |