Valsartan
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10218 |
| Alternative Name(s) | Diovan;(2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid; Diovan, Tareg, Provas, Kalpress, Miten |
| Research Area | Valsartan is an angiotensin-receptor blocker (ARB) that may be used to treat a variety of cardiac conditions including hypertension, diabetic nephropathy and heart failure. |
| Molecular Formula | C24H29N5O3 |
| CAS# | 137862-53-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CCCC)N([C@H](C(O)=O)C(C)C)CC1=CC=C(C2=C(C3=NN=NN3)C=CC=C2)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10218.html |
| Additional Information | NULL |