Pheniramine Maleate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11711 |
| Alternative Name(s) | 1-Phenyl-1-(2-pyridyl)-3-dimethylaminopropane Maleate; 2-[α-[2-(Dimethylamino)ethyl]benzyl]pyridine Maleate |
| Research Area | Pheniramine, a H1-receptor antagonist, is an antihistamine with anticholinergic and sedative properties. Pheniramine is used to treat allergic conditions such as hay fever or urticaria. |
| Molecular Formula | C20H24N2O4 |
| CAS# | 132-20-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C)CCC(C1=CC=CC=N1)C2=CC=CC=C2.OC(/C=CC(O)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11711.html |
| Additional Information | NULL |