Baclofen
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00944 |
| Alternative Name(s) | 4-amino-3-anoc cid |
| Research Area | For the alleviation of signs and symptoms of spasticity resulting from multiple sclerosis, particularly for the relief of flexor spasms and concomitant pain, clonus, and muscular rigidity. |
| Molecular Formula | C10H1ClNO2 |
| CAS# | 1134-47-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NCC(C1=CC=C(Cl)C=C1)CC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00944.html |
| Additional Information | NULL |