Testosterone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02507 |
| Alternative Name(s) | 17β-Hydroxy-3-oxo-4-androstene, 17β-Hydroxy-4-androsten-3-one, 4-Androsten-17β-ol-3-one, trans-Testosterone |
| Research Area | Therapeutic Testosterone is a synthetic form of the endogenous androgenic steroid testosterone. In vivo, testosterone is irreversibly converted to dihydrotestosterone (DHT) in target tissues by the enzyme 5-alpha reductase. Testosterone or DHT ligand-andr |
| Molecular Formula | C19H28O2 |
| CAS# | 58-22-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C(CC1)=CC2=O)(CC2)[C@]3([H])[C@]1([H])[C@@](CC[C@@H]4O)([H])[C@]4(C)CC3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02507.html |
| Additional Information | NULL |