Tibolone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02470 |
| Alternative Name(s) | (1S,9R,10R,11S,14R,15S)-14-ethynyl-14-hydroxy-9,15-dimethyltetrcclo[8.7.0.0²,7.0¹¹,¹5]heptadc-2(7)-en-5-one |
| Research Area | Tibolone is a synthetic anabolic steroid with estrogenic, androgenic and progestagenic activities. The 3alpha- and 3beta-hydroxy metabolites of tibilone activate estrogenic receptors (ERs) in bone and vaginal tissue leading to a decrease in bone turnover, |
| Molecular Formula | C21H28O2 |
| CAS# | 5630-53-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@H](CC(CC1=O)=C(CC1)[C@@]2([H])CC3)[C@@]2([H])[C@@](CC[C@@]4(O)C#C)([H])[C@]34C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02470.html |
| Additional Information | NULL |