Tigecycline
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02445 |
| Alternative Name(s) | (4S,4aS,5aR,12aR)-9-[2-(tert-butylamin1,10,11,12a-tetrahydroxy-3,12-dioxo-3,4,4a,5,5a,6,12,12e-2carboxamide;9-t-Butylglcylamido-minccline; TBG-MINO; Tigcclin; Tygcil |
| Research Area | Tigecycline is a broad-spectrum glycylcycline antibiotic derived from tetracycline. Tigecycline binds to the 30S ribosomal subunit, thereby interfering with the binding of aminoacyl-tRNA to the mRNA-ribosome complex. This prevents the incorporation of ami |
| Molecular Formula | C29H39N5O8 |
| CAS# | 220620-09-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](C(O)=C(C(C1=C(C(NC(CNC(C)(C)C)=O)=C2)O)=O)[C@](CC1=C2N(C)C)([H])C3)(C(C(C(N)=O)=C4O)=O)[C@]3([H])[C@@H]4N(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02445.html |
| Additional Information | NULL |