Thalidomide
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02490 |
| Alternative Name(s) | (RS)-2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione;CS-AR-00201 |
| Research Area | A piperidinyl isoindole originally introduced as a non-barbiturate hypnotic, but withdrawn from the market due to teratogenic effects. It has been reintroduced and used for a number of immunological and inflammatory disorders. Thalidomide displays immunos |
| Molecular Formula | C13H10N2O4 |
| CAS# | 50-35-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=C2C=CC=C1)N(C(CCC3=O)C(N3)=O)C2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02490.html |
| Additional Information | NULL |