Triclosan
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02526 |
| Alternative Name(s) | 2,4,4'-trchloro-2'-hydroxydiphenyl ether; 5chloro-(2,4-dchlorophenoxy)phenol; trchloro-2'-hydroxydiphenyl ether;cH3565; Lexol 300; Irgasan DP 300; Ster-Zc |
| Research Area | Triclosan is a polychloro phenoxy phenol with antibacterial and antifungal activity. Triclosan is added to toothpastes to prevent gingivitis and has been added to many household products for its topical antibiotic activity. |
| Molecular Formula | C12HCl3O2 |
| CAS# | 3380-34-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C=CC(Cl)=C1)OC(C=CC(Cl)=C2)=C2O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02526.html |
| Additional Information | NULL |