Dabigatran
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-03403 |
| Alternative Name(s) | Ethyl 3-{[(2-{[(4-{N'-hexylno]methyl}-1- |
| Research Area | Dabigatran is a THROMBIN inhibitor which acts by binding and blocking thrombogenic activity and the prevention of thrombus formation. It is used to reduce the risk of stroke and systemic EMBOLISM in patients with nonvalvular atrial fibrillation. |
| Molecular Formula | C25H25N7O3 |
| CAS# | 211914-51-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1C2=CC=C(C(N(C3=CC=CC=N3)CCC(O)=O)=O)C=C2N=C1CNC4=CC=C(C(N)=N)C=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03403.html |
| Additional Information | NULL |