Calcium Pantothenate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00303 |
| Alternative Name(s) | calcium (R)-3-(2,4-dihydroxy-3,3-dimethylbutanamido)propanoate |
| Research Area | Calcium Pantothenate is the calcium salt of the water-soluble vitamin B5, ubiquitously found in plants and animal tissues with antioxidant property. Pentothenate is a component of coenzyme A (CoA) and a part of the vitamin B2 complex. Vitamin B5 is a grow |
| Molecular Formula | C18H32CaN2O10 |
| CAS# | 79-83-4 (Free acid) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C(NCCC([O-])=O)=O)C(C)(C)CO.O[C@@H](C(NCCC([O-])=O)=O)C(C)(C)CO.[Ca+2] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00303.html |
| Additional Information | NULL |