Cyproterone Acetate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01143 |
| Alternative Name(s) | Andrcur |
| Research Area | The free alcHydroxyol is an anti-androgen; the acetate is both an anti-androgen and a progestogen. Combined with estrogen it is used in the treatment of acne. |
| Molecular Formula | C24H2ClO4 |
| CAS# | 427-51-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]([C@]1([H])[C@]2([H])[C@@](CC[C@@]3(C(C)=O)OC(C)=O)([H])[C@]3(C)CC1)(C(C(Cl)=C2)=CC4=O)[C@@H]5[C@H]4C5 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01143.html |
| Additional Information | NULL |