Ibuprofen
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01647 |
| Alternative Name(s) | Ibuprofen; Motrin; Brufen; 2-(4-Isobutylphenyl)propa(2-methylpropyl)phenyl]propanoic acid |
| Research Area | Ibuprofen is a nonsteroidal anti-inflammatory agent with analgesic properties used in the therapy of rheumatism and arthritis. |
| Molecular Formula | C13H18O2 |
| CAS# | 15687-27-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C1=CC=C(CC(C)C)C=C1)C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01647.html |
| Additional Information | NULL |