Levamisole
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01732 |
| Alternative Name(s) | (S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole hydrochloride |
| Research Area | Levamisole is an antihelminthic drug that has been tried experimentally in rheumatic disorders where it apparently restores the immune response by increasing macrophage chemotaxis and T-lymphocyte function |
| Molecular Formula | C11H12N2S |
| CAS# | 14769-73-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [C@H]1(C2=CC=CC=C2)CN(CCS3)C3=N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01732.html |
| Additional Information | NULL |