Tylosin Tartrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02412 |
| Alternative Name(s) | Pharmasin |
| Research Area | Tylosin is a bacteriostat feed additive used in veterinary medicine. It has a broad spectrum of activity against Gram-positive organisms and a limited range of Gram-negative organisms. It is found naturally as a fermentation product of Streptomyces fradi |
| Molecular Formula | C46H77NO17C4H4O6 |
| CAS# | 1405-54-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C(O)=O)[C@@H](O)C(O)=O.C[C@@H](O[C@@]1([H])O[C@H]([C@H]([C@@H](CC2=O)O)C)[C@H](C[C@H](C(/C=C/C(C)=C/[C@H](CO[C@H](O[C@H](C)[C@@H](O)[C@H]3OC)[C@@H]3OC)[C@@H](CC)O2)=O)C)CC=O)[C@H]([C@@H]([C@H]1O)N(C)C)O[C@@](O[C@@H](C)[C@@H]4O)([H])C[C@]4(O)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02412.html |
| Additional Information | NULL |