Trimetazidine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02456 |
| Alternative Name(s) | 1-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| Research Area | Trimetazidine is an anti-ischemic (anti-anginal) metabolic agent, which improves myocardial glucose utilization through inhibition of long-chain 3-ketoacyl CoA thiolase activity, which results in a reduction in fatty acid oxidation and a stimulation of gl |
| Molecular Formula | C14H22N2O3 |
| CAS# | 5011-34-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=C(C=CC(OC)=C1OC)CN2CCNCC2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02456.html |
| Additional Information | NULL |