Lincomycin Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01742 |
| Alternative Name(s) | Lincomycin hydrochloride; LINCOMYCIN HCL; Lincomycin; Lincocin Hydrochloride; Lincomycin (hydrochloride); UNII-GCW8Y9936L; |
| Research Area | An epimer of Lincomycin (L466200); a 6-amino, 6-deoxy-octopyraninose with strong antibiotic activity. A less potent bactericidal than its (7R)-epimer. |
| Molecular Formula | C18H34N2O6SHCl |
| CAS# | 17017-22-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@H](O)[C@@]([C@@]([C@@H]([C@H](O)[C@H]1O)O)([H])O[C@@H]1SC)([H])NC([C@@H]2C[C@@H](CCC)CN2C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01742.html |
| Additional Information | NULL |