Carvedilol
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-07551 |
| Alternative Name(s) | Coropress;1-(yphenoxy)ethyl]amino]-2-propanlum;Dilatrend;Eucardic;Kredex;Querto;Carvedilolum, |
| Research Area | Carvedilol is a non-selective beta blocker indicated in the treatment of mild to moderate congestive heart failure (CHF). It blocks beta-1 and beta-2 adrenergic receptors as well as the alpha-1 adrenergic receptors. |
| Molecular Formula | C24H26N2O4 |
| CAS# | 72956-09-03 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CNCCOC(C=CC=C1)=C1OC)COC2=CC=CC3=C2C4=CC=CC=C4N3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07551.html |
| Additional Information | NULL |
