Sulfadimidine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02309 |
| Alternative Name(s) | Sulfadimidine;Sulphamethazine |
| Research Area | Sulfamethazine is a sulfanilamide anti-infective agent. It has a spectrum of antimicrobial action similar to other sulfonamides. Sulfamethazine is a sulfonamide antibiotic used in the lifestock industry. |
| Molecular Formula | C12H14N4O2S |
| CAS# | 57-68-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC1=NC(C)=CC(C)=N1)(C2=CC=C(N)C=C2)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02309.html |
| Additional Information | NULL |