Dimenhydrinate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00255 |
| Alternative Name(s) | 8-chloro-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione compound with 2-(benzhydryloxy)-N,N-dimethylethanamine (1:1) |
| Research Area | An antihistamine with antiemetic properties used to prevent nausea and motion sicknes composed of two drugs 8-Chlorotheophylline and Diphenhydramine . |
| Molecular Formula | C24H28ClN5O3 |
| CAS# | 523-87-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.O=C(N3C)C(N=C(Cl)N4)=C4N(C)C3=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00255.html |
| Additional Information | NULL |