Clomiphene Citrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-06320 |
| Alternative Name(s) | Clomphid;clostilbegyt; Dynerc; Pergotime |
| Research Area | Clomiphene is a non-steroidal fertility medicine. It causes the pituitary gland to release hormones needed to stimulate ovulation (the release of an egg from the ovary). |
| Molecular Formula | C32H3ClNO8 |
| CAS# | 50-41-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CC(O)=O)(C(O)=O)CC(O)=O.Cl/C(C1=CC=CC=C1)=C(C2=CC=CC=C2)/C3=CC=C(OCCN(CC)CC)C=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06320.html |
| Additional Information | NULL |