Risperidone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02221 |
| Alternative Name(s) | 3-(2-(4-(6-fluorobenzo[d]isoxazol-3-yl)piperidin-1-yl)ethyl)-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one |
| Research Area | Risperidone is a benzisoxazole derivative with antipsychotic property. Risperidone selectively antagonizes serotonin (5-HT) effects via cortical 5-HT2 receptor, and, to a lesser extent, competes with dopamine at the limbic dopamine D2 receptor.It has been |
| Molecular Formula | C23H27FN4O2 |
| CAS# | 106266-06-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1=CC(ON=C2C3CCN(CCC(C(N(CCCC4)C4=N5)=O)=C5C)CC3)=C2C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02221.html |
| Additional Information | NULL |