Miconazole Nitrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-07918 |
| Alternative Name(s) | 1-[2-(2,4-Dichlorobenzyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole Nitrate |
| Research Area | Miconazole nitrate is an imidazole antifungal agent that is used topically and by intravenous infusion. |
| Molecular Formula | C18H14Cl4N2O.HNO3 |
| CAS# | 22832-87-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[N](O)=O.ClC1=C(C=CC(Cl)=C1)C(OCC(C=CC(Cl)=C2)=C2Cl)CN3C=CN=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07918.html |
| Additional Information | NULL |