Citicoline Sodium Salt
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-06231 |
| Alternative Name(s) | 5'-O-[({[2-(Triméthylammonio)éthoxy]phosphinato}oxy)phosphinato]cytidine de sodium |
| Research Area | Naturally occurring nucleotide; intermediate in the major pathway of lecitin biosynthesis. Neuroprotective. It is used in the treatment of ischemic stroke and head trauma. |
| Molecular Formula | C14H25N4NaO11P2 |
| CAS# | 33818-15-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]1[C@H](N(C=CC(N)=N2)C2=O)O[C@H](CO[P](O[P](OCC[N+](C)(C)C)([O-])=O)(O)=O)[C@H]1O.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06231.html |
| Additional Information | NULL |