Folic Acid
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11653 |
| Alternative Name(s) | Vitamin B11;Vitamin B9;L-Pteroylglutamic acid; |
| Research Area | A vitamin needed to synthesize DNA, conduct DNA repair and methylate DNA, it also acts as a cofactor in biological reactions involving folate. |
| Molecular Formula | C19H19N7O6 |
| CAS# | 59-30-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=NC(CNC3=CC=C(C(N[C@H](C(O)=O)CCC(O)=O)=O)C=C3)=CNC2=NC(N)=N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11653.html |
| Additional Information | NULL |