Furamide
API Standard
| Trivial name | NULL |
| Catalog Number | CS-T-24916 |
| Alternative Name(s) | Furamide;Diloxanide furoate; |
| Research Area | Furamide is an ambecide, an anti-protozoal drug used in the treatment of amoebozoa infections. |
| Molecular Formula | C14H11Cl2NO5 |
| CAS# | 3736-81-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C1=CC=C(OC(C2=CC=CO2)=O)C=C1)C(C(Cl)Cl)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST24916.html |
| Additional Information | NULL |