Clarithromycin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00499 |
| Alternative Name(s) | 6-O-Methylerythr56268; Abbott 56268; Antibiiotc TE 31; BIAXIN XL; Biaxin;cRIXAN OD;clamcin;clarc;claris;claritek;clarith;clarithro;clarithromcin;clathromcin;crixan; Facar; Fromilid; |
| Research Area | A semisynthetic macrolide antibiotic derived from ERYTHROMYCIN that is active against a variety of microorganisms. It can inhibit protein synthesis in bacteria by reversibly binding to the 50S ribosomal subunits. This inhibits the translocation of aminoacyl transfer-RNA and prevents peptide chain elongation. |
| Molecular Formula | C38H69NO13 |
| CAS# | 81103-11-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](OC)(C[C@H](C([C@@H]1C)=O)C)[C@@H]([C@H]([C@@H]([C@H](C(O[C@H](CC)[C@@](C)(O)[C@@H]1O)=O)C)O[C@@](O[C@@H](C)[C@@H]2O)([H])C[C@@]2(C)OC)C)O[C@@](O[C@H](C)C[C@@H]3N(C)C)([H])[C@@H]3O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00499.html |
| Additional Information | NULL |